C34H53O10PSi — CID 69336760
[(2S,3R,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-phosphonooxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 69336760) has the molecular formula C34H53O10PSi and a molecular weight of 680.85 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-phosphonooxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-phosphonooxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 69336760 |
| Molecular Formula | C34H53O10PSi |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-phosphonooxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)[Si](OC[C@H]1O[C@@H](OP(=O)(O)O)[C@H](OC(=O)C(C)(C)C)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H53O10PSi/c1-23(2)46(24(3)4,25(5)6)41-22-28-29(39-20-26-16-12-10-13-17-26)30(40-21-27-18-14-11-15-19-27)31(43-33(35)34(7,8)9)32(42-28)44-45(36,37)38/h10-19,23-25,28-32H,20-22H2,1-9H3,(H2,36,37,38)/t28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | MSFQAITXDOHRSH-VJLURNNQSA-N |
| XLogP | 7.14 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|