C29H42O4Si — CID 10885348
[(2R,3R,4R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 10885348) has the molecular formula C29H42O4Si and a molecular weight of 482.74 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R,4R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10885348 |
| Molecular Formula | C29H42O4Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1OC=C[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H42O4Si/c1-22(2)34(23(3)4,24(5)6)33-21-28-29(32-20-26-15-11-8-12-16-26)27(17-18-30-28)31-19-25-13-9-7-10-14-25/h7-18,22-24,27-29H,19-21H2,1-6H3/t27-,28-,29-/m1/s1 |
| InChIKey | HYRNILZGEVKFKU-MPFGFTFXSA-N |
| XLogP | 7.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|