C29H41BrO4Si — CID 101161369
[(2R,3S,4R)-4-[(4-bromophenyl)methoxy]-3-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 101161369) has the molecular formula C29H41BrO4Si and a molecular weight of 561.63 g/mol. Its IUPAC name is [(2R,3S,4R)-4-[(4-bromophenyl)methoxy]-3-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,4R)-4-[(4-bromophenyl)methoxy]-3-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101161369 |
| Molecular Formula | C29H41BrO4Si |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | [(2R,3S,4R)-4-[(4-bromophenyl)methoxy]-3-phenylmethoxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1OC=C[C@@H](OCc2ccc(Br)cc2)[C@@H]1OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H41BrO4Si/c1-21(2)35(22(3)4,23(5)6)34-20-28-29(33-19-24-10-8-7-9-11-24)27(16-17-31-28)32-18-25-12-14-26(30)15-13-25/h7-17,21-23,27-29H,18-20H2,1-6H3/t27-,28-,29+/m1/s1 |
| InChIKey | SAIZYLINOFYQHB-NLDZOOGBSA-N |
| XLogP | 8.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|