C42H82O5SSi3 — CID 102374439
[(2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-(phenylmethoxymethyl)-3,5-bis[tri(propan-2-yl)silyloxy]oxan-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 102374439) has the molecular formula C42H82O5SSi3 and a molecular weight of 783.44 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-(phenylmethoxymethyl)-3,5-bis[tri(propan-2-yl)silyloxy]oxan-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-(phenylmethoxymethyl)-3,5-bis[tri(propan-2-yl)silyloxy]oxan-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102374439 |
| Molecular Formula | C42H82O5SSi3 |
| Molecular Weight | 783.44 g/mol |
| Exact Mass | 782.52 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-(phenylmethoxymethyl)-3,5-bis[tri(propan-2-yl)silyloxy]oxan-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H82O5SSi3/c1-20-48-42-41(47-51(34(14)15,35(16)17)36(18)19)40(46-50(31(8)9,32(10)11)33(12)13)39(45-49(28(2)3,29(4)5)30(6)7)38(44-42)27-43-26-37-24-22-21-23-25-37/h21-25,28-36,38-42H,20,26-27H2,1-19H3/t38-,39-,40+,41-,42+/m1/s1 |
| InChIKey | XXPBYSCSKXLCGW-DJLQKWJRSA-N |
| XLogP | 13.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.44 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|