C53H90O11SSi3 — CID 77138995
[6-ethylsulfanyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methyl 3,5-diacetyloxy-4-phenylmethoxybenzoate (PubChem CID 77138995) has the molecular formula C53H90O11SSi3 and a molecular weight of 1019.62 g/mol. Its IUPAC name is [6-ethylsulfanyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methyl 3,5-diacetyloxy-4-phenylmethoxybenzoate.
| Compound Name | [6-ethylsulfanyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methyl 3,5-diacetyloxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 77138995 |
| Molecular Formula | C53H90O11SSi3 |
| Molecular Weight | 1019.62 g/mol |
| Exact Mass | 1018.55 |
| IUPAC Name | [6-ethylsulfanyl-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methyl 3,5-diacetyloxy-4-phenylmethoxybenzoate |
| SMILES | CCSC1OC(COC(=O)c2cc(OC(C)=O)c(OCc3ccccc3)c(OC(C)=O)c2)C(O[Si](C(C)C)(C(C)C)C(C)C)C(O[Si](C(C)C)(C(C)C)C(C)C)C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C53H90O11SSi3/c1-22-65-53-51(64-68(38(14)15,39(16)17)40(18)19)50(63-67(35(8)9,36(10)11)37(12)13)49(62-66(32(2)3,33(4)5)34(6)7)47(61-53)31-58-52(56)44-28-45(59-41(20)54)48(46(29-44)60-42(21)55)57-30-43-26-24-23-25-27-43/h23-29,32-40,47,49-51,53H,22,30-31H2,1-21H3 |
| InChIKey | TXLKONWKNOEJQD-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.62 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|