C45H48O10S — CID 171040021
[(2R,3S,4S,5R,6S)-3,5-dibenzoyloxy-4-(3-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl)oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 171040021) has the molecular formula C45H48O10S and a molecular weight of 780.94 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,5-dibenzoyloxy-4-(3-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl)oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,5-dibenzoyloxy-4-(3-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl)oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 171040021 |
| Molecular Formula | C45H48O10S |
| Molecular Weight | 780.94 g/mol |
| Exact Mass | 780.30 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,5-dibenzoyloxy-4-(3-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl)oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(CC2CCCCC2)C(=O)OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C45H48O10S/c1-2-56-45-40(55-43(48)35-26-16-7-17-27-35)39(52-36(28-31-18-8-3-9-19-31)44(49)50-29-32-20-10-4-11-21-32)38(54-42(47)34-24-14-6-15-25-34)37(53-45)30-51-41(46)33-22-12-5-13-23-33/h4-7,10-17,20-27,31,36-40,45H,2-3,8-9,18-19,28-30H2,1H3/t36?,37-,38+,39+,40-,45+/m1/s1 |
| InChIKey | YYYMOUZAOSPUSU-KHRNOHFRSA-N |
| XLogP | 8.24 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.94 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|