C24H36O7S — CID 15489422
benzyl (2S)-3-cyclohexyl-2-[(2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate (PubChem CID 15489422) has the molecular formula C24H36O7S and a molecular weight of 468.61 g/mol. Its IUPAC name is benzyl (2S)-3-cyclohexyl-2-[(2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate.
| Compound Name | benzyl (2S)-3-cyclohexyl-2-[(2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate |
|---|---|
| PubChem CID | 15489422 |
| Molecular Formula | C24H36O7S |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | benzyl (2S)-3-cyclohexyl-2-[(2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate |
| SMILES | CCS[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@H](CC2CCCCC2)C(=O)OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C24H36O7S/c1-2-32-24-21(27)22(20(26)19(14-25)31-24)30-18(13-16-9-5-3-6-10-16)23(28)29-15-17-11-7-4-8-12-17/h4,7-8,11-12,16,18-22,24-27H,2-3,5-6,9-10,13-15H2,1H3/t18-,19+,20-,21+,22-,24-/m0/s1 |
| InChIKey | VNZMCUZAQJTXQA-FDXLXGPUSA-N |
| XLogP | 2.65 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |