C44H42O8S — CID 122365994
[(2S,3R,4S,5S,6R)-2-ethylsulfanyl-6-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 122365994) has the molecular formula C44H42O8S and a molecular weight of 730.88 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-ethylsulfanyl-6-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-ethylsulfanyl-6-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 122365994 |
| Molecular Formula | C44H42O8S |
| Molecular Weight | 730.88 g/mol |
| Exact Mass | 730.26 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-ethylsulfanyl-6-(9H-fluoren-9-ylmethoxycarbonyloxymethyl)-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1O[C@H](COC(=O)OCC2c3ccccc3-c3ccccc32)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H42O8S/c1-2-53-43-41(52-42(45)32-20-10-5-11-21-32)40(48-27-31-18-8-4-9-19-31)39(47-26-30-16-6-3-7-17-30)38(51-43)29-50-44(46)49-28-37-35-24-14-12-22-33(35)34-23-13-15-25-36(34)37/h3-25,37-41,43H,2,26-29H2,1H3/t38-,39+,40+,41-,43+/m1/s1 |
| InChIKey | SVCYTUHYYGBBNZ-SVWZSAIMSA-N |
| XLogP | 8.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.88 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |