C42H68O2Si2 — CID 123548581
[(1S,4S,4aS,5S,7S,8aR)-6-but-2-en-2-yl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 123548581) has the molecular formula C42H68O2Si2 and a molecular weight of 661.18 g/mol. Its IUPAC name is [(1S,4S,4aS,5S,7S,8aR)-6-but-2-en-2-yl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,4S,4aS,5S,7S,8aR)-6-but-2-en-2-yl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 123548581 |
| Molecular Formula | C42H68O2Si2 |
| Molecular Weight | 661.18 g/mol |
| Exact Mass | 660.48 |
| IUPAC Name | [(1S,4S,4aS,5S,7S,8aR)-6-but-2-en-2-yl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC=C(C)C1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2[C@@H](C[C@@H]1C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@H]2C |
| InChI | InChI=1S/C42H68O2Si2/c1-14-32(8)40-34(10)27-37-39(44-45(29(2)3,30(4)5)31(6)7)26-25-33(9)41(37)38(40)28-43-46(42(11,12)13,35-21-17-15-18-22-35)36-23-19-16-20-24-36/h14-24,29-31,33-34,37-41H,25-28H2,1-13H3/t33-,34-,37-,38+,39-,40?,41+/m0/s1 |
| InChIKey | CILGERLAOHUDDY-YFMMOYKSSA-N |
| XLogP | 11.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.18 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|