C35H56O4Si2 — CID 11180922
(2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-3-ol (PubChem CID 11180922) has the molecular formula C35H56O4Si2 and a molecular weight of 597.00 g/mol. Its IUPAC name is (2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-3-ol.
| Compound Name | (2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-3-ol |
|---|---|
| PubChem CID | 11180922 |
| Molecular Formula | C35H56O4Si2 |
| Molecular Weight | 597.00 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | (2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-3-ol |
| SMILES | C=CC[C@H]1O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O |
| InChI | InChI=1S/C35H56O4Si2/c1-11-18-32-34(36)33(39-40(26(2)3,27(4)5)28(6)7)25-29(38-32)23-24-37-41(35(8,9)10,30-19-14-12-15-20-30)31-21-16-13-17-22-31/h11-17,19-22,26-29,32-34,36H,1,18,23-25H2,2-10H3/t29-,32-,33-,34-/m1/s1 |
| InChIKey | ZRTAYJJONCWLGM-HHAIGBBTSA-N |
| XLogP | 7.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.00 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|