C37H60O6Si2 — CID 11388218
3-[(2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-tri(propan-2-yl)silyloxyoxan-2-yl]propyl acetate (PubChem CID 11388218) has the molecular formula C37H60O6Si2 and a molecular weight of 657.05 g/mol. Its IUPAC name is 3-[(2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-tri(propan-2-yl)silyloxyoxan-2-yl]propyl acetate.
| Compound Name | 3-[(2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-tri(propan-2-yl)silyloxyoxan-2-yl]propyl acetate |
|---|---|
| PubChem CID | 11388218 |
| Molecular Formula | C37H60O6Si2 |
| Molecular Weight | 657.05 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 3-[(2R,3R,4R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-tri(propan-2-yl)silyloxyoxan-2-yl]propyl acetate |
| SMILES | CC(=O)OCCC[C@H]1O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O |
| InChI | InChI=1S/C37H60O6Si2/c1-27(2)44(28(3)4,29(5)6)43-35-26-31(42-34(36(35)39)22-17-24-40-30(7)38)23-25-41-45(37(8,9)10,32-18-13-11-14-19-32)33-20-15-12-16-21-33/h11-16,18-21,27-29,31,34-36,39H,17,22-26H2,1-10H3/t31-,34-,35-,36-/m1/s1 |
| InChIKey | GJJBBVJXNKEEOT-MBWVZDRISA-N |
| XLogP | 7.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.05 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|