C36H58O4Si2 — CID 101393356
(2R)-4-[(2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-6-yl]butan-2-ol (PubChem CID 101393356) has the molecular formula C36H58O4Si2 and a molecular weight of 611.03 g/mol. Its IUPAC name is (2R)-4-[(2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-6-yl]butan-2-ol.
| Compound Name | (2R)-4-[(2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-6-yl]butan-2-ol |
|---|---|
| PubChem CID | 101393356 |
| Molecular Formula | C36H58O4Si2 |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | (2R)-4-[(2S,4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-6-yl]butan-2-ol |
| SMILES | CC(C)[Si](O[C@@H]1C=C(CC[C@@H](C)O)O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H58O4Si2/c1-27(2)41(28(3)4,29(5)6)40-33-25-31(22-21-30(7)37)39-32(26-33)23-24-38-42(36(8,9)10,34-17-13-11-14-18-34)35-19-15-12-16-20-35/h11-20,25,27-30,32-33,37H,21-24,26H2,1-10H3/t30-,32+,33-/m1/s1 |
| InChIKey | ZRNBWRRICWKRCF-NGYIUDBNSA-N |
| XLogP | 8.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|