C38H62O5Si2 — CID 134878824
(2R)-6-[(1S,3R,5R,6S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-1-yl]hexan-2-ol (PubChem CID 134878824) has the molecular formula C38H62O5Si2 and a molecular weight of 655.08 g/mol. Its IUPAC name is (2R)-6-[(1S,3R,5R,6S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-1-yl]hexan-2-ol.
| Compound Name | (2R)-6-[(1S,3R,5R,6S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-1-yl]hexan-2-ol |
|---|---|
| PubChem CID | 134878824 |
| Molecular Formula | C38H62O5Si2 |
| Molecular Weight | 655.08 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | (2R)-6-[(1S,3R,5R,6S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-tri(propan-2-yl)silyloxy-2,7-dioxabicyclo[4.1.0]heptan-1-yl]hexan-2-ol |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@]2(CCCC[C@@H](C)O)O[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H62O5Si2/c1-28(2)44(29(3)4,30(5)6)43-35-27-32(41-38(36(35)42-38)25-18-17-19-31(7)39)24-26-40-45(37(8,9)10,33-20-13-11-14-21-33)34-22-15-12-16-23-34/h11-16,20-23,28-32,35-36,39H,17-19,24-27H2,1-10H3/t31-,32-,35-,36+,38+/m1/s1 |
| InChIKey | QGHFCOVAZWHHRO-HOSNBFEZSA-N |
| XLogP | 8.34 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.08 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|