C17H32O2Si — CID 134931804
[(2S,5R)-5-but-3-enyl-3,5-dimethyl-2H-furan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134931804) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(2S,5R)-5-but-3-enyl-3,5-dimethyl-2H-furan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,5R)-5-but-3-enyl-3,5-dimethyl-2H-furan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134931804 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(2S,5R)-5-but-3-enyl-3,5-dimethyl-2H-furan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@]1(C)C=C(C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O2Si/c1-9-10-11-17(6)12-14(2)15(19-17)13-18-20(7,8)16(3,4)5/h9,12,15H,1,10-11,13H2,2-8H3/t15-,17-/m1/s1 |
| InChIKey | MZMLKWUMUKNNHD-NVXWUHKLSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|