C15H30O3Si — CID 57385207
(2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-5-prop-2-enyloxolan-3-ol (PubChem CID 57385207) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is (2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-5-prop-2-enyloxolan-3-ol.
| Compound Name | (2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-5-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 57385207 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (2S,3R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methyl-5-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@]1(C)C[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H30O3Si/c1-8-9-15(5)10-12(16)13(18-15)11-17-19(6,7)14(2,3)4/h8,12-13,16H,1,9-11H2,2-7H3/t12-,13+,15-/m1/s1 |
| InChIKey | RGCIUBLADZVGKI-VNHYZAJKSA-N |
| XLogP | 3.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|