C12H26O3Si — CID 10105989
tert-butyl-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 10105989) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is tert-butyl-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10105989 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | tert-butyl-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | CC1(C)OC[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H26O3Si/c1-11(2,3)16(6,7)14-9-10-8-13-12(4,5)15-10/h10H,8-9H2,1-7H3/t10-/m1/s1 |
| InChIKey | MKYCOWRYIJJQGD-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|