C10H22O3Si — CID 152706381
tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane (PubChem CID 152706381) has the molecular formula C10H22O3Si and a molecular weight of 218.37 g/mol. Its IUPAC name is tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane.
| Compound Name | tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane |
|---|---|
| PubChem CID | 152706381 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1COCO1 |
| InChI | InChI=1S/C10H22O3Si/c1-10(2,3)14(4,5)13-7-9-6-11-8-12-9/h9H,6-8H2,1-5H3 |
| InChIKey | ZSQUHGJBJQBHSH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|