About tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane
tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane (PubChem CID 152706381) has the molecular formula C10H22O3Si
and a molecular weight of 218.37 g/mol. Its IUPAC name is tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane |
| PubChem CID | 152706381 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1COCO1 |
| InChI | InChI=1S/C10H22O3Si/c1-10(2,3)14(4,5)13-7-9-6-11-8-12-9/h9H,6-8H2,1-5H3 |
| InChIKey | ZSQUHGJBJQBHSH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane?
The IUPAC name of tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane (CID 152706381) is tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane.
What is the SMILES notation for tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane?
The canonical SMILES for tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane is CC(C)(C)[Si](C)(C)OCC1COCO1.
What is the InChIKey of tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane?
The InChIKey is ZSQUHGJBJQBHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3Si/c1-10(2,3)14(4,5)13-7-9-6-11-8-12-9/h9H,6-8H2,1-5H3.
What are the key properties of tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane?
tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane has a molecular weight of 218.37 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(1,3-dioxolan-4-ylmethoxy)-dimethylsilane is sourced from PubChem (CID 152706381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).