C11H25NO3Si — CID 100978692
tert-butyl-[(3-hydroxy-1,3-oxazinan-6-yl)methoxy]-dimethylsilane (PubChem CID 100978692) has the molecular formula C11H25NO3Si and a molecular weight of 247.41 g/mol. Its IUPAC name is tert-butyl-[(3-hydroxy-1,3-oxazinan-6-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-hydroxy-1,3-oxazinan-6-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100978692 |
| Molecular Formula | C11H25NO3Si |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | tert-butyl-[(3-hydroxy-1,3-oxazinan-6-yl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCN(O)CO1 |
| InChI | InChI=1S/C11H25NO3Si/c1-11(2,3)16(4,5)15-8-10-6-7-12(13)9-14-10/h10,13H,6-9H2,1-5H3 |
| InChIKey | DXQHCHYZXZMPFA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|