C17H39NO2Si2 — CID 15042667
trans-(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropan-1-amine (PubChem CID 15042667) has the molecular formula C17H39NO2Si2 and a molecular weight of 345.68 g/mol. Its IUPAC name is trans-(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropan-1-amine.
| Compound Name | trans-(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 15042667 |
| Molecular Formula | C17H39NO2Si2 |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | trans-(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C(N)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H39NO2Si2/c1-16(2,3)21(7,8)19-11-13-14(15(13)18)12-20-22(9,10)17(4,5)6/h13-15H,11-12,18H2,1-10H3/t13-,14-/m1/s1 |
| InChIKey | DGHQYXYNJVLMOE-ZIAGYGMSSA-N |
| XLogP | 4.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|