C13H29NO3Si — CID 174151218
(3S,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxan-3-amine (PubChem CID 174151218) has the molecular formula C13H29NO3Si and a molecular weight of 275.46 g/mol. Its IUPAC name is (3S,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxan-3-amine.
| Compound Name | (3S,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxan-3-amine |
|---|---|
| PubChem CID | 174151218 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (3S,4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxyoxan-3-amine |
| SMILES | CO[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC[C@@H]1N |
| InChI | InChI=1S/C13H29NO3Si/c1-13(2,3)18(5,6)17-8-10-7-12(15-4)11(14)9-16-10/h10-12H,7-9,14H2,1-6H3/t10-,11-,12-/m0/s1 |
| InChIKey | LUEKIPVMPDBVNM-SRVKXCTJSA-N |
| XLogP | 2.14 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|