C6H13NO2 — CID 131220331
(3S,5S)-5-(methoxymethyl)oxolan-3-amine (PubChem CID 131220331) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (3S,5S)-5-(methoxymethyl)oxolan-3-amine.
| Compound Name | (3S,5S)-5-(methoxymethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 131220331 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S,5S)-5-(methoxymethyl)oxolan-3-amine |
| SMILES | COC[C@@H]1C[C@H](N)CO1 |
| InChI | InChI=1S/C6H13NO2/c1-8-4-6-2-5(7)3-9-6/h5-6H,2-4,7H2,1H3/t5-,6-/m0/s1 |
| InChIKey | XDUNNKVBOHTIJG-WDSKDSINSA-N |
| XLogP | -0.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |