C7H15NO2 — CID 141449393
(3R,6S)-6-(deuteriomethoxymethyl)oxan-3-amine (PubChem CID 141449393) has the molecular formula C7H15NO2 and a molecular weight of 146.21 g/mol. Its IUPAC name is (3R,6S)-6-(deuteriomethoxymethyl)oxan-3-amine.
| Compound Name | (3R,6S)-6-(deuteriomethoxymethyl)oxan-3-amine |
|---|---|
| PubChem CID | 141449393 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | (3R,6S)-6-(deuteriomethoxymethyl)oxan-3-amine |
| SMILES | [2H]COC[C@@H]1CC[C@@H](N)CO1 |
| InChI | InChI=1S/C7H15NO2/c1-9-5-7-3-2-6(8)4-10-7/h6-7H,2-5,8H2,1H3/t6-,7+/m1/s1/i1D |
| InChIKey | JAJFLERONKHAJQ-IXJUOEFQSA-N |
| XLogP | 0.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |