C12H23NO2 — CID 158173740
(3R,6S)-6-[2-(3-methylcyclobutyl)oxyethyl]oxan-3-amine (PubChem CID 158173740) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (3R,6S)-6-[2-(3-methylcyclobutyl)oxyethyl]oxan-3-amine.
| Compound Name | (3R,6S)-6-[2-(3-methylcyclobutyl)oxyethyl]oxan-3-amine |
|---|---|
| PubChem CID | 158173740 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (3R,6S)-6-[2-(3-methylcyclobutyl)oxyethyl]oxan-3-amine |
| SMILES | CC1CC(OCC[C@@H]2CC[C@@H](N)CO2)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9-6-12(7-9)14-5-4-11-3-2-10(13)8-15-11/h9-12H,2-8,13H2,1H3/t9?,10-,11+,12?/m1/s1 |
| InChIKey | KDVCUQTWNDXQHY-UPOSSJBDSA-N |
| XLogP | 1.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |