C8H18N2O3 — CID 11977040
(6S)-6-(methoxymethoxymethyl)oxane-3,4-diamine (PubChem CID 11977040) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is (6S)-6-(methoxymethoxymethyl)oxane-3,4-diamine.
| Compound Name | (6S)-6-(methoxymethoxymethyl)oxane-3,4-diamine |
|---|---|
| PubChem CID | 11977040 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (6S)-6-(methoxymethoxymethyl)oxane-3,4-diamine |
| SMILES | COCOC[C@@H]1CC(N)C(N)CO1 |
| InChI | InChI=1S/C8H18N2O3/c1-11-5-12-3-6-2-7(9)8(10)4-13-6/h6-8H,2-5,9-10H2,1H3/t6-,7?,8?/m0/s1 |
| InChIKey | NVQCALFUAPYCFZ-KKMMWDRVSA-N |
| XLogP | -0.95 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|