C12H24O4 — CID 20981483
4,5-diethoxy-2-(ethoxymethyl)oxane (PubChem CID 20981483) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,5-diethoxy-2-(ethoxymethyl)oxane.
| Compound Name | 4,5-diethoxy-2-(ethoxymethyl)oxane |
|---|---|
| PubChem CID | 20981483 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,5-diethoxy-2-(ethoxymethyl)oxane |
| SMILES | CCOCC1CC(OCC)C(OCC)CO1 |
| InChI | InChI=1S/C12H24O4/c1-4-13-8-10-7-11(14-5-2)12(9-16-10)15-6-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | ORNJJGFJQLRNSN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |