C15H28O2 — CID 159848161
2-(ethoxymethyl)oxirane;3-propylbicyclo[4.1.0]heptane (PubChem CID 159848161) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(ethoxymethyl)oxirane;3-propylbicyclo[4.1.0]heptane.
| Compound Name | 2-(ethoxymethyl)oxirane;3-propylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 159848161 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-(ethoxymethyl)oxirane;3-propylbicyclo[4.1.0]heptane |
| SMILES | CCCC1CCC2CC2C1.CCOCC1CO1 |
| InChI | InChI=1S/C10H18.C5H10O2/c1-2-3-8-4-5-9-7-10(9)6-8;1-2-6-3-5-4-7-5/h8-10H,2-7H2,1H3;5H,2-4H2,1H3 |
| InChIKey | NPORRRHVZMGYIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|