C15H28O3 — CID 158695451
2-(propoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane (PubChem CID 158695451) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(propoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 2-(propoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 158695451 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-(propoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane |
| SMILES | CCCC1CCC2OC2C1.CCCOCC1CO1 |
| InChI | InChI=1S/C9H16O.C6H12O2/c1-2-3-7-4-5-8-9(6-7)10-8;1-2-3-7-4-6-5-8-6/h7-9H,2-6H2,1H3;6H,2-5H2,1H3 |
| InChIKey | IGWOTRBEYKVDLF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|