C24H44O7 — CID 158931989
4-(butoxymethyl)-1,3-dioxolan-2-one;2-(butoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane (PubChem CID 158931989) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 4-(butoxymethyl)-1,3-dioxolan-2-one;2-(butoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 4-(butoxymethyl)-1,3-dioxolan-2-one;2-(butoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 158931989 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 4-(butoxymethyl)-1,3-dioxolan-2-one;2-(butoxymethyl)oxirane;3-propyl-7-oxabicyclo[4.1.0]heptane |
| SMILES | CCCC1CCC2OC2C1.CCCCOCC1CO1.CCCCOCC1COC(=O)O1 |
| InChI | InChI=1S/C9H16O.C8H14O4.C7H14O2/c1-2-3-7-4-5-8-9(6-7)10-8;1-2-3-4-10-5-7-6-11-8(9)12-7;1-2-3-4-8-5-7-6-9-7/h7-9H,2-6H2,1H3;7H,2-6H2,1H3;7H,2-6H2,1H3 |
| InChIKey | JJEHVZZBEBITSE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|