C40H76O4Si3 — CID 58891764
2-[2,4-bis[2-[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]ethyl]cyclohexyl]ethyl-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 58891764) has the molecular formula C40H76O4Si3 and a molecular weight of 705.30 g/mol. Its IUPAC name is 2-[2,4-bis[2-[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]ethyl]cyclohexyl]ethyl-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | 2-[2,4-bis[2-[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]ethyl]cyclohexyl]ethyl-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 58891764 |
| Molecular Formula | C40H76O4Si3 |
| Molecular Weight | 705.30 g/mol |
| Exact Mass | 704.51 |
| IUPAC Name | 2-[2,4-bis[2-[dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silyl]ethyl]cyclohexyl]ethyl-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C[Si](C)(CCC1CCC(CC[Si](C)(C)CCCOCC2CO2)C(CC[Si](C)(C)CCC2CCC3OC3C2)C1)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C40H76O4Si3/c1-45(2,20-7-19-41-29-36-30-42-36)24-17-34-11-8-31(14-21-46(3,4)22-15-32-9-12-37-39(27-32)43-37)26-35(34)18-25-47(5,6)23-16-33-10-13-38-40(28-33)44-38/h31-40H,7-30H2,1-6H3 |
| InChIKey | FMQQTXGMYVXDGT-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 46.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.30 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|