C16H32O5 — CID 118346921
(1S,2R,4S,5S)-1,2,3,4,5-pentaethoxycyclohexane (PubChem CID 118346921) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,2R,4S,5S)-1,2,3,4,5-pentaethoxycyclohexane.
| Compound Name | (1S,2R,4S,5S)-1,2,3,4,5-pentaethoxycyclohexane |
|---|---|
| PubChem CID | 118346921 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (1S,2R,4S,5S)-1,2,3,4,5-pentaethoxycyclohexane |
| SMILES | CCOC1[C@@H](OCC)[C@@H](OCC)C[C@H](OCC)[C@H]1OCC |
| InChI | InChI=1S/C16H32O5/c1-6-17-12-11-13(18-7-2)15(20-9-4)16(21-10-5)14(12)19-8-3/h12-16H,6-11H2,1-5H3/t12-,13-,14-,15+,16?/m0/s1 |
| InChIKey | RZLOEEFRGRVZQJ-WDFJATGCSA-N |
| XLogP | 2.42 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |