C14H26O6 — CID 102237665
(3S,3aS,6R,6aS)-3,6-bis(2-ethoxyethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 102237665) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3S,3aS,6R,6aS)-3,6-bis(2-ethoxyethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aS,6R,6aS)-3,6-bis(2-ethoxyethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 102237665 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3S,3aS,6R,6aS)-3,6-bis(2-ethoxyethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CCOCCO[C@H]1CO[C@@H]2[C@H]1OC[C@H]2OCCOCC |
| InChI | InChI=1S/C14H26O6/c1-3-15-5-7-17-11-9-19-14-12(10-20-13(11)14)18-8-6-16-4-2/h11-14H,3-10H2,1-2H3/t11-,12+,13-,14-/m0/s1 |
| InChIKey | KCVXAGGMZFDKLE-CRWXNKLISA-N |
| XLogP | 0.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|