C10H18O5 — CID 170789483
3-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propan-1-ol (PubChem CID 170789483) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 3-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propan-1-ol.
| Compound Name | 3-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 170789483 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-[[(3R,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]propan-1-ol |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OCCCO |
| InChI | InChI=1S/C10H18O5/c1-12-7-5-14-10-8(6-15-9(7)10)13-4-2-3-11/h7-11H,2-6H2,1H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | YCVNJARGGXPDSB-ZYUZMQFOSA-N |
| XLogP | -0.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|