C14H25NO5 — CID 66990422
4-[2-[[(3R,3aS,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]piperidine (PubChem CID 66990422) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[2-[[(3R,3aS,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]piperidine.
| Compound Name | 4-[2-[[(3R,3aS,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]piperidine |
|---|---|
| PubChem CID | 66990422 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-[2-[[(3R,3aS,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]ethoxy]piperidine |
| SMILES | CO[C@@H]1CO[C@H]2[C@H]1OC[C@H]2OCCOC1CCNCC1 |
| InChI | InChI=1S/C14H25NO5/c1-16-11-8-19-14-12(9-20-13(11)14)18-7-6-17-10-2-4-15-5-3-10/h10-15H,2-9H2,1H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | IUUJATJKZPMIBV-YIYPIFLZSA-N |
| XLogP | -0.05 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|