C9H16O5 — CID 118967664
(3S,6S)-3-methoxy-6-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 118967664) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (3S,6S)-3-methoxy-6-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,6S)-3-methoxy-6-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 118967664 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (3S,6S)-3-methoxy-6-(methoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | COCO[C@H]1COC2C1OC[C@@H]2OC |
| InChI | InChI=1S/C9H16O5/c1-10-5-14-7-4-13-8-6(11-2)3-12-9(7)8/h6-9H,3-5H2,1-2H3/t6-,7-,8?,9?/m0/s1 |
| InChIKey | AFJQJZUPHNWOIJ-MSIFESELSA-N |
| XLogP | -0.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|