C8H16O6 — CID 134850656
(3R,4S)-3,4-bis(methoxymethoxy)oxolan-2-ol (PubChem CID 134850656) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (3R,4S)-3,4-bis(methoxymethoxy)oxolan-2-ol.
| Compound Name | (3R,4S)-3,4-bis(methoxymethoxy)oxolan-2-ol |
|---|---|
| PubChem CID | 134850656 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (3R,4S)-3,4-bis(methoxymethoxy)oxolan-2-ol |
| SMILES | COCO[C@H]1COC(O)[C@@H]1OCOC |
| InChI | InChI=1S/C8H16O6/c1-10-4-13-6-3-12-8(9)7(6)14-5-11-2/h6-9H,3-5H2,1-2H3/t6-,7+,8?/m0/s1 |
| InChIKey | IXOQCXCVIKWOTG-KJFJCRTCSA-N |
| XLogP | -0.69 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|