C5H10ClO3P — CID 12609879
2-chloro-4-(ethoxymethyl)-1,3,2-dioxaphospholane (PubChem CID 12609879) has the molecular formula C5H10ClO3P and a molecular weight of 184.56 g/mol. Its IUPAC name is 2-chloro-4-(ethoxymethyl)-1,3,2-dioxaphospholane.
| Compound Name | 2-chloro-4-(ethoxymethyl)-1,3,2-dioxaphospholane |
|---|---|
| PubChem CID | 12609879 |
| Molecular Formula | C5H10ClO3P |
| Molecular Weight | 184.56 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2-chloro-4-(ethoxymethyl)-1,3,2-dioxaphospholane |
| SMILES | CCOCC1COP(Cl)O1 |
| InChI | InChI=1S/C5H10ClO3P/c1-2-7-3-5-4-8-10(6)9-5/h5H,2-4H2,1H3 |
| InChIKey | GTFJXSFNNWWEEM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|