About trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine
trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine (PubChem CID 131115476) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine.
Analyze trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine?
The IUPAC name of trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine (CID 131115476) is trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine.
What is the SMILES notation for trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine?
The canonical SMILES for trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine is COC[C@@H]1C[C@@H]1N.
What is the InChIKey of trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine?
The InChIKey is QFUWGKZFJBYYGC-WHFBIAKZSA-N. The full InChI is InChI=1S/C5H11NO/c1-7-3-4-2-5(4)6/h4-5H,2-3,6H2,1H3/t4-,5-/m0/s1.
What are the key properties of trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine?
trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine has a molecular weight of 101.15 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-(methoxymethyl)cyclopropan-1-amine is sourced from PubChem (CID 131115476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).