C7H15NO2 — CID 55300146
(2S,5S)-2-(methoxymethyl)-5-methylmorpholine (PubChem CID 55300146) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (2S,5S)-2-(methoxymethyl)-5-methylmorpholine.
| Compound Name | (2S,5S)-2-(methoxymethyl)-5-methylmorpholine |
|---|---|
| PubChem CID | 55300146 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (2S,5S)-2-(methoxymethyl)-5-methylmorpholine |
| SMILES | COC[C@@H]1CN[C@@H](C)CO1 |
| InChI | InChI=1S/C7H15NO2/c1-6-4-10-7(3-8-6)5-9-2/h6-8H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | JQNRMIFYOZIDRN-BQBZGAKWSA-N |
| XLogP | 0.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |