C20H42O3Si — CID 11360349
tert-butyl-[9-(2,2-dimethyl-1,3-dioxolan-4-yl)nonoxy]-dimethylsilane (PubChem CID 11360349) has the molecular formula C20H42O3Si and a molecular weight of 358.64 g/mol. Its IUPAC name is tert-butyl-[9-(2,2-dimethyl-1,3-dioxolan-4-yl)nonoxy]-dimethylsilane.
| Compound Name | tert-butyl-[9-(2,2-dimethyl-1,3-dioxolan-4-yl)nonoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11360349 |
| Molecular Formula | C20H42O3Si |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | tert-butyl-[9-(2,2-dimethyl-1,3-dioxolan-4-yl)nonoxy]-dimethylsilane |
| SMILES | CC1(C)OCC(CCCCCCCCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H42O3Si/c1-19(2,3)24(6,7)22-16-14-12-10-8-9-11-13-15-18-17-21-20(4,5)23-18/h18H,8-17H2,1-7H3 |
| InChIKey | CSWGZEVAHWJHLG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|