C12H22F2OSi — CID 166560955
tert-butyl-[[(1R,3S)-3-ethenyl-2,2-difluorocyclopropyl]methoxy]-dimethylsilane (PubChem CID 166560955) has the molecular formula C12H22F2OSi and a molecular weight of 248.39 g/mol. Its IUPAC name is tert-butyl-[[(1R,3S)-3-ethenyl-2,2-difluorocyclopropyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3S)-3-ethenyl-2,2-difluorocyclopropyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 166560955 |
| Molecular Formula | C12H22F2OSi |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl-[[(1R,3S)-3-ethenyl-2,2-difluorocyclopropyl]methoxy]-dimethylsilane |
| SMILES | C=C[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)C1(F)F |
| InChI | InChI=1S/C12H22F2OSi/c1-7-9-10(12(9,13)14)8-15-16(5,6)11(2,3)4/h7,9-10H,1,8H2,2-6H3/t9-,10-/m0/s1 |
| InChIKey | NZAJYHVTISQWDK-UWVGGRQHSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|