C14H28O2Si — CID 10682540
(1S)-1-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]but-3-en-1-ol (PubChem CID 10682540) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (1S)-1-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]but-3-en-1-ol.
| Compound Name | (1S)-1-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 10682540 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (1S)-1-[(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]but-3-en-1-ol |
| SMILES | C=CC[C@H](O)[C@@H]1C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-7-8-13(15)12-9-11(12)10-16-17(5,6)14(2,3)4/h7,11-13,15H,1,8-10H2,2-6H3/t11-,12+,13-/m0/s1 |
| InChIKey | ZOZDPYYSZSMOGE-XQQFMLRXSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|