C18H36O2Si — CID 101099555
cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (PubChem CID 101099555) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol.
| Compound Name | cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 101099555 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCC1CC1C(O)C1CCCC1 |
| InChI | InChI=1S/C18H36O2Si/c1-13(2)18(3,4)21(5,6)20-12-15-11-16(15)17(19)14-9-7-8-10-14/h13-17,19H,7-12H2,1-6H3 |
| InChIKey | QAZUCZCGUXZCSJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|