About cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol
cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (PubChem CID 101099555) has the molecular formula C18H36O2Si
and a molecular weight of 312.57 g/mol. Its IUPAC name is cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| PubChem CID | 101099555 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCC1CC1C(O)C1CCCC1 |
| InChI | InChI=1S/C18H36O2Si/c1-13(2)18(3,4)21(5,6)20-12-15-11-16(15)17(19)14-9-7-8-10-14/h13-17,19H,7-12H2,1-6H3 |
| InChIKey | QAZUCZCGUXZCSJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol?
The IUPAC name of cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (CID 101099555) is cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol.
What is the SMILES notation for cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol?
The canonical SMILES for cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol is CC(C)C(C)(C)[Si](C)(C)OCC1CC1C(O)C1CCCC1.
What is the InChIKey of cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol?
The InChIKey is QAZUCZCGUXZCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2Si/c1-13(2)18(3,4)21(5,6)20-12-15-11-16(15)17(19)14-9-7-8-10-14/h13-17,19H,7-12H2,1-6H3.
What are the key properties of cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol?
cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol has a molecular weight of 312.57 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol is sourced from PubChem (CID 101099555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).