C26H50O2Si — CID 164987019
2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;(5,6-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 164987019) has the molecular formula C26H50O2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;(5,6-dimethylcyclohex-3-en-1-yl)methanol.
| Compound Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;(5,6-dimethylcyclohex-3-en-1-yl)methanol |
|---|---|
| PubChem CID | 164987019 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane;(5,6-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CC1C=CCC(CO)C1C.CC1C=CCC(CO[Si](C)(C)C(C)(C)C(C)C)C1C |
| InChI | InChI=1S/C17H34OSi.C9H16O/c1-13(2)17(5,6)19(7,8)18-12-16-11-9-10-14(3)15(16)4;1-7-4-3-5-9(6-10)8(7)2/h9-10,13-16H,11-12H2,1-8H3;3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | GHPYXKMNKDDCJI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|