C20H42O2Si2 — CID 14961478
[(1R,2R)-2-trimethylsilyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methanol (PubChem CID 14961478) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is [(1R,2R)-2-trimethylsilyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methanol.
| Compound Name | [(1R,2R)-2-trimethylsilyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 14961478 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | [(1R,2R)-2-trimethylsilyl-1-[tri(propan-2-yl)silyloxymethyl]cyclohex-3-en-1-yl]methanol |
| SMILES | CC(C)[Si](OC[C@]1(CO)CCC=C[C@H]1[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42O2Si2/c1-16(2)24(17(3)4,18(5)6)22-15-20(14-21)13-11-10-12-19(20)23(7,8)9/h10,12,16-19,21H,11,13-15H2,1-9H3/t19-,20-/m1/s1 |
| InChIKey | UCHAZDBFAVMHLR-WOJBJXKFSA-N |
| XLogP | 6.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|