C25H52O2Si — CID 123989502
3,3,5,8,8-pentamethyl-11-tri(propan-2-yl)silyloxyundec-5-en-1-ol (PubChem CID 123989502) has the molecular formula C25H52O2Si and a molecular weight of 412.78 g/mol. Its IUPAC name is 3,3,5,8,8-pentamethyl-11-tri(propan-2-yl)silyloxyundec-5-en-1-ol.
| Compound Name | 3,3,5,8,8-pentamethyl-11-tri(propan-2-yl)silyloxyundec-5-en-1-ol |
|---|---|
| PubChem CID | 123989502 |
| Molecular Formula | C25H52O2Si |
| Molecular Weight | 412.78 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 3,3,5,8,8-pentamethyl-11-tri(propan-2-yl)silyloxyundec-5-en-1-ol |
| SMILES | CC(=CCC(C)(C)CCCO[Si](C(C)C)(C(C)C)C(C)C)CC(C)(C)CCO |
| InChI | InChI=1S/C25H52O2Si/c1-20(2)28(21(3)4,22(5)6)27-18-12-14-24(8,9)15-13-23(7)19-25(10,11)16-17-26/h13,20-22,26H,12,14-19H2,1-11H3 |
| InChIKey | XQMXXPMEDVNEFB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.78 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|