C20H38OSi — CID 45259142
(4E,5R,6E,8R,9Z)-5,8-dimethyl-4-(trimethylsilylmethylidene)tetradeca-6,9-dien-1-ol (PubChem CID 45259142) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is (4E,5R,6E,8R,9Z)-5,8-dimethyl-4-(trimethylsilylmethylidene)tetradeca-6,9-dien-1-ol.
| Compound Name | (4E,5R,6E,8R,9Z)-5,8-dimethyl-4-(trimethylsilylmethylidene)tetradeca-6,9-dien-1-ol |
|---|---|
| PubChem CID | 45259142 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | (4E,5R,6E,8R,9Z)-5,8-dimethyl-4-(trimethylsilylmethylidene)tetradeca-6,9-dien-1-ol |
| SMILES | CCCC/C=C\[C@@H](C)/C=C/[C@@H](C)/C(=C/[Si](C)(C)C)CCCO |
| InChI | InChI=1S/C20H38OSi/c1-7-8-9-10-12-18(2)14-15-19(3)20(13-11-16-21)17-22(4,5)6/h10,12,14-15,17-19,21H,7-9,11,13,16H2,1-6H3/b12-10-,15-14+,20-17+/t18-,19-/m1/s1 |
| InChIKey | CIYQZJJYFKPPQH-AQXYXGOQSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|