C20H36OSi — CID 135008828
(5Z,8E,10Z,13E)-10-methyl-8-(trimethylsilylmethylidene)pentadeca-5,10,13-trien-1-ol (PubChem CID 135008828) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is (5Z,8E,10Z,13E)-10-methyl-8-(trimethylsilylmethylidene)pentadeca-5,10,13-trien-1-ol.
| Compound Name | (5Z,8E,10Z,13E)-10-methyl-8-(trimethylsilylmethylidene)pentadeca-5,10,13-trien-1-ol |
|---|---|
| PubChem CID | 135008828 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (5Z,8E,10Z,13E)-10-methyl-8-(trimethylsilylmethylidene)pentadeca-5,10,13-trien-1-ol |
| SMILES | C/C=C/C/C=C(/C)C/C(=C/[Si](C)(C)C)C/C=C\CCCCO |
| InChI | InChI=1S/C20H36OSi/c1-6-7-11-14-19(2)17-20(18-22(3,4)5)15-12-9-8-10-13-16-21/h6-7,9,12,14,18,21H,8,10-11,13,15-17H2,1-5H3/b7-6+,12-9-,19-14-,20-18+ |
| InChIKey | DXJGSVYWDKVBKX-KIBVCTIRSA-N |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|