C16H32O2Si — CID 53341832
(E)-9-[tert-butyl(dimethyl)silyl]oxy-6-methylidenenon-4-en-1-ol (PubChem CID 53341832) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (E)-9-[tert-butyl(dimethyl)silyl]oxy-6-methylidenenon-4-en-1-ol.
| Compound Name | (E)-9-[tert-butyl(dimethyl)silyl]oxy-6-methylidenenon-4-en-1-ol |
|---|---|
| PubChem CID | 53341832 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (E)-9-[tert-butyl(dimethyl)silyl]oxy-6-methylidenenon-4-en-1-ol |
| SMILES | C=C(/C=C/CCCO)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-15(11-8-7-9-13-17)12-10-14-18-19(5,6)16(2,3)4/h8,11,17H,1,7,9-10,12-14H2,2-6H3/b11-8+ |
| InChIKey | RCPMGROQOMCDPU-DHZHZOJOSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|