C11H22OSi — CID 14961487
[(1R,4R)-2-methyl-4-trimethylsilylcyclohex-2-en-1-yl]methanol (PubChem CID 14961487) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is [(1R,4R)-2-methyl-4-trimethylsilylcyclohex-2-en-1-yl]methanol.
| Compound Name | [(1R,4R)-2-methyl-4-trimethylsilylcyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 14961487 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(1R,4R)-2-methyl-4-trimethylsilylcyclohex-2-en-1-yl]methanol |
| SMILES | CC1=C[C@H]([Si](C)(C)C)CC[C@H]1CO |
| InChI | InChI=1S/C11H22OSi/c1-9-7-11(13(2,3)4)6-5-10(9)8-12/h7,10-12H,5-6,8H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | XTYDWAAFZLAOLG-WDEREUQCSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|