C16H33FO2Si — CID 15092897
1-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3,7-dimethyloct-6-en-2-ol (PubChem CID 15092897) has the molecular formula C16H33FO2Si and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3,7-dimethyloct-6-en-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3,7-dimethyloct-6-en-2-ol |
|---|---|
| PubChem CID | 15092897 |
| Molecular Formula | C16H33FO2Si |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-3,7-dimethyloct-6-en-2-ol |
| SMILES | CC(C)=CCCC(C)(F)C(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33FO2Si/c1-13(2)10-9-11-16(6,17)14(18)12-19-20(7,8)15(3,4)5/h10,14,18H,9,11-12H2,1-8H3 |
| InChIKey | XRLZPZPEGWXWIN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|